CAS 87887-70-5

Piperazine, 1-(4-chlorobenzoyl)-4-(diphenylmethyl)-, hydrochloride

Description:

Piperazine, 1-(4-chlorobenzoyl)-4-(diphenylmethyl)-, hydrochloride, with the CAS number 87887-70-5, is a chemical compound that belongs to the piperazine class of compounds. It typically exhibits a white to off-white crystalline appearance and is soluble in water and organic solvents, which is characteristic of many piperazine derivatives. This compound is known for its potential pharmacological properties, often being investigated for its effects in various biological systems. The presence of the 4-chlorobenzoyl and diphenylmethyl groups contributes to its unique chemical reactivity and interaction with biological targets. As a hydrochloride salt, it is often more stable and easier to handle than its free base form. Safety data sheets should be consulted for handling and toxicity information, as with any chemical substance, to ensure proper safety protocols are followed in laboratory or industrial settings.

Formula: C₂₄H₂₃ClN₂OxClH

InChI: InChI=1S/C24H23ClN2O.ClH/c25-22-13-11-21(12-14-22)24(28)27-17-15-26(16-18-27)23(19-7-3-1-4-8-19)20-9-5-2-6-10-20;/h1-14,23H,15-18H2;1H

InChI key: SBUICDJUCAYZCR-UHFFFAOYSA-N

SMILES: C1CN(CCN1C(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)C4=CC=C(C=C4)Cl.Cl

Piperazine, 1-(4-chlorobenzoyl)-4-(diphenylmethyl)-, hydrochloride

CAS: 87887-70-5

Formula: C₂₄H₂₄Cl₂N₂O

Molecular weight: 427.3662

Ref: IN-DA004E6S