CAS 87891-77-8

9H-Fluorene-2-carboxamide, N,9-dimethyl-9-propyl-

Description:

9H-Fluorene-2-carboxamide, N,9-dimethyl-9-propyl- is an organic compound characterized by its structure, which includes a fluorene backbone with a carboxamide functional group and additional alkyl substituents. The presence of the dimethyl and propyl groups contributes to its hydrophobic nature, influencing its solubility and interaction with other substances. This compound may exhibit properties typical of amides, such as potential hydrogen bonding capabilities, which can affect its boiling and melting points. Additionally, the fluorene moiety is known for its stability and aromatic characteristics, which can impart unique electronic properties. The compound may be of interest in various fields, including materials science and organic synthesis, due to its potential applications in creating novel materials or as intermediates in chemical reactions. Safety data and handling precautions should be considered, as with any chemical substance, to ensure proper usage and minimize risks.

Formula: C₁₉H₂₁NO

InChI: InChI=1S/C19H21NO/c1-4-11-19(2)16-8-6-5-7-14(16)15-10-9-13(12-17(15)19)18(21)20-3/h5-10,12H,4,11H2,1-3H3,(H,20,21)

InChI key: STIIGEUCNJZBDX-UHFFFAOYSA-N

SMILES: CCCC1(C2=CC=CC=C2C3=C1C=C(C=C3)C(=O)NC)C

9H-Fluorene-2-carboxamide, N,9-dimethyl-9-propyl-

CAS: 87891-77-8

Formula: C₁₉H₂₁NO

Molecular weight: 279.3761

Ref: IN-DA004E6M