CymitQuimica logo

CAS 879-60-7

:

1,3,4-Oxadiazol-2(3H)-one, 3-methyl-5-phenyl-

Description:
1,3,4-Oxadiazol-2(3H)-one, 3-methyl-5-phenyl- (CAS 879-60-7) is a heterocyclic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in its five-membered structure. This compound features a methyl group and a phenyl group, contributing to its unique chemical properties and potential applications. It is typically a white to off-white solid and is soluble in organic solvents, which makes it useful in various chemical reactions and syntheses. The oxadiazole moiety is known for its biological activity, and derivatives of this compound may exhibit antimicrobial, antifungal, or anti-inflammatory properties. Additionally, the presence of the phenyl group can enhance the compound's stability and influence its electronic properties, making it of interest in materials science and medicinal chemistry. As with many heterocycles, the reactivity of this compound can be influenced by the substituents on the ring, allowing for further functionalization and exploration in synthetic applications.
Formula:C9H8N2O2
InChI:InChI=1S/C9H8N2O2/c1-11-9(12)13-8(10-11)7-5-3-2-4-6-7/h2-6H,1H3
InChI key:JBDTUVFVJKCGHG-UHFFFAOYSA-N
SMILES:CN1C(=O)OC(=N1)C2=CC=CC=C2
Found 1 products.