CAS 87900-51-4

2(1H)-Naphthalenone, 1,7-dihydroxy-1,6-dimethyl-4-(1-methylethyl)-

Description:

2(1H)-Naphthalenone, 1,7-dihydroxy-1,6-dimethyl-4-(1-methylethyl)-, with the CAS number 87900-51-4, is an organic compound characterized by its complex structure, which includes a naphthalene backbone with various functional groups. This compound features two hydroxyl (-OH) groups, which contribute to its potential as a phenolic compound, influencing its reactivity and solubility in polar solvents. The presence of methyl groups and an isopropyl group enhances its hydrophobic characteristics, affecting its interaction with biological systems and its overall stability. The compound may exhibit antioxidant properties due to the presence of hydroxyl groups, making it of interest in various fields, including pharmaceuticals and materials science. Its unique structure may also impart specific biological activities, although detailed studies would be necessary to elucidate its full range of properties and potential applications. As with many organic compounds, safety data and handling precautions should be considered when working with this substance.

Formula: C₁₅H₁₈O₃

InChI: InChI=1S/C15H18O3/c1-8(2)10-6-14(17)15(4,18)12-7-13(16)9(3)5-11(10)12/h5-8,16,18H,1-4H3

InChI key: JLCJSBOHWRDWQW-UHFFFAOYSA-N

SMILES: CC1=CC2=C(C=C1O)C(C(=O)C=C2C(C)C)(C)O

2(1H)-Naphthalenone, 1,7-dihydroxy-1,6-dimethyl-4-(1-methylethyl)-

CAS: 87900-51-4

Formula: C₁₅H₁₈O₃

Molecular weight: 246.3016

Ref: IN-DA004E0F