CAS 87903-19-3

Pyridine, 5-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-1,2-dihydro-2-phenyl-

Description:

Pyridine, 5-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-1,2-dihydro-2-phenyl- is a heterocyclic organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a complex substituent that includes a dihydro-oxazole moiety and a phenyl group, contributing to its unique chemical properties. Typically, compounds of this nature exhibit moderate to high polarity due to the presence of nitrogen and oxygen atoms, which can engage in hydrogen bonding and dipole interactions. The presence of the phenyl group may enhance the compound's hydrophobic characteristics, influencing its solubility in organic solvents. Additionally, the dihydro-oxazole ring can impart specific reactivity, making it potentially useful in various chemical reactions or as a building block in synthetic organic chemistry. The compound's specific applications and behavior would depend on its structural features and the functional groups present, which could affect its reactivity, stability, and interactions with other substances.

Formula: C₁₆H₁₈N₂O

InChI: InChI=1S/C16H18N2O/c1-16(2)11-19-15(18-16)13-8-9-14(17-10-13)12-6-4-3-5-7-12/h3-10,14,18H,11H2,1-2H3

InChI key: IAJNURBLKMNCPE-UHFFFAOYSA-N

SMILES: CC1(COC(=C2C=CC(N=C2)C3=CC=CC=C3)N1)C

Pyridine, 5-(4,5-dihydro-4,4-dimethyl-2-oxazolyl)-1,2-dihydro-2-phenyl-

CAS: 87903-19-3

Formula: C₁₆H₁₈N₂O

Molecular weight: 254.3269

Ref: IN-DA004FH0