CAS 87919-34-4

3-(4-chlorophenyl)-1,1-bis(2-hydroxyethyl)urea

Description:

3-(4-chlorophenyl)-1,1-bis(2-hydroxyethyl)urea, with the CAS number 87919-34-4, is an organic compound characterized by its urea functional group and the presence of a 4-chlorophenyl substituent. This compound typically exhibits properties associated with both hydrophilicity and lipophilicity due to the presence of hydroxyl groups and an aromatic ring. It is likely to be soluble in polar solvents, such as water and alcohols, while also showing some degree of solubility in organic solvents. The chlorophenyl group may impart specific biological activity, making this compound of interest in pharmaceutical and agricultural applications. Its structure suggests potential interactions with biological systems, possibly influencing enzyme activity or receptor binding. Additionally, the presence of hydroxyl groups can enhance hydrogen bonding capabilities, affecting its physical properties such as melting point and boiling point. Overall, this compound's unique structure and functional groups contribute to its potential utility in various chemical and biological contexts.

Formula: C₁₁H₁₅ClN₂O₃

InChI: InChI=1/C11H15ClN2O3/c12-9-1-3-10(4-2-9)13-11(17)14(5-7-15)6-8-16/h1-4,15-16H,5-8H2,(H,13,17)

InChI key: XFXDDTFEODFCCS-UHFFFAOYSA-N

SMILES: C1=CC(=CC=C1NC(=O)N(CCO)CCO)Cl

3-(4-chlorophenyl)-1,1-bis(2-hydroxyethyl)urea

CAS: 87919-34-4

Formula: C₁₁H₁₅ClN₂O₃

Molecular weight: 258.7014

Ref: IN-DA004FER