CAS 87919-77-5

Silacyclopent-2-ene, 1,1-dimethyl-4,5-diphenyl-, trans-

Description:

Silacyclopent-2-ene, 1,1-dimethyl-4,5-diphenyl-, trans- is an organosilicon compound characterized by its unique silacyclopentene structure, which incorporates silicon into a cyclic framework. This compound features a five-membered ring with a silicon atom replacing one of the carbon atoms, contributing to its distinct chemical properties. The presence of two methyl groups at the 1-position and two phenyl groups at the 4 and 5 positions enhances its stability and influences its reactivity. The trans configuration indicates that the substituents are positioned opposite each other, which can affect the compound's physical properties, such as boiling point and solubility. Silacyclopent-2-ene derivatives are of interest in materials science and organic synthesis due to their potential applications in creating novel polymers and as intermediates in chemical reactions. Additionally, the incorporation of silicon can impart unique electronic and optical properties, making such compounds valuable in various technological applications. Overall, this compound exemplifies the intersection of organic and inorganic chemistry, showcasing the versatility of silicon in organic frameworks.

Formula: C₁₈H₂₀Si

InChI: InChI=1S/C18H20Si/c1-19(2)14-13-17(15-9-5-3-6-10-15)18(19)16-11-7-4-8-12-16/h3-14,17-18H,1-2H3/t17-,18-/m0/s1

InChI key: NHMBEEPTCMPOKO-ROUUACIJSA-N

SMILES: C[Si]1(C=C[C@H]([C@@H]1C2=CC=CC=C2)C3=CC=CC=C3)C

Silacyclopent-2-ene, 1,1-dimethyl-4,5-diphenyl-, trans-

CAS: 87919-77-5

Formula: C₁₈H₂₀Si

Molecular weight: 264.4369

Ref: IN-DA004DQX