CAS 87922-27-8

Pyridine, 1,4-dihydro-1-octyl-4-(1-octyl-4(1H)-pyridinylidene)-

Description:

Pyridine, 1,4-dihydro-1-octyl-4-(1-octyl-4(1H)-pyridinylidene)-, identified by CAS number 87922-27-8, is a chemical compound that features a pyridine ring, which is a six-membered aromatic ring containing one nitrogen atom. This compound is characterized by its long hydrocarbon chains, specifically octyl groups, which contribute to its hydrophobic properties. The presence of the dihydropyridine structure indicates that it has two hydrogen atoms added to the pyridine ring, which can influence its reactivity and stability. Pyridine derivatives are often utilized in various applications, including as solvents, in organic synthesis, and in the production of agrochemicals and pharmaceuticals. The unique structure of this compound may impart specific biological activities or interactions, making it of interest in medicinal chemistry. Additionally, the presence of multiple functional groups can affect its solubility, boiling point, and overall chemical behavior in different environments. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₂₆H₄₂N₂

InChI: InChI=1S/C26H42N2/c1-3-5-7-9-11-13-19-27-21-15-25(16-22-27)26-17-23-28(24-18-26)20-14-12-10-8-6-4-2/h15-18,21-24H,3-14,19-20H2,1-2H3

InChI key: BIAUQEDQPLUDQZ-UHFFFAOYSA-N

SMILES: CCCCCCCCN1C=CC(=C2C=CN(C=C2)CCCCCCCC)C=C1

Pyridine, 1,4-dihydro-1-octyl-4-(1-octyl-4(1H)-pyridinylidene)-

CAS: 87922-27-8

Formula: C₂₆H₄₂N₂

Molecular weight: 382.6251

Ref: IN-DA004DO1