CymitQuimica logo

CAS 87941-55-7

:

4-Bromo-1-trityl-1H-imidazole

Description:
4-Bromo-1-trityl-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered aromatic heterocycle containing two nitrogen atoms. The presence of a bromine atom at the 4-position of the imidazole ring introduces a halogen substituent, which can influence the compound's reactivity and properties. The trityl group, a bulky triphenylmethyl substituent, is attached to the nitrogen atom at the 1-position, enhancing the compound's stability and solubility in organic solvents. This compound is typically used in organic synthesis and medicinal chemistry, often serving as an intermediate in the preparation of more complex molecules. Its unique structure allows for potential applications in various fields, including pharmaceuticals and materials science. The compound's properties, such as melting point, solubility, and reactivity, can vary based on the specific conditions and solvents used in experiments. As with many brominated compounds, it may exhibit specific biological activities, making it of interest for further research in drug development.
Formula:C22H17BrN2
InChI:InChI=1/C22H17BrN2/c23-21-16-25(17-24-21)22(18-10-4-1-5-11-18,19-12-6-2-7-13-19)20-14-8-3-9-15-20/h1-17H
InChI key:BSQFJBYJUQJNMZ-UHFFFAOYSA-N
SMILES:c1ccc(cc1)C(c1ccccc1)(c1ccccc1)n1cc(Br)nc1
Synonyms:
  • 4-Bromo-1-tritylimidazole
Found 4 products.