CAS 879484-77-2

Benzaldehyde, 4-[(4-methyl-1-piperazinyl)methyl]-,mono(trifluoroacetate)

Description:

Benzaldehyde, 4-[(4-methyl-1-piperazinyl)methyl]-, mono(trifluoroacetate) is a chemical compound characterized by its structure, which includes a benzaldehyde moiety substituted with a piperazine derivative. This compound features a trifluoroacetate functional group, which contributes to its unique chemical properties. The presence of the piperazine ring suggests potential biological activity, as piperazine derivatives are often associated with pharmacological effects. The trifluoroacetate group enhances the compound's solubility in organic solvents and may influence its reactivity and stability. In terms of physical properties, it is likely to be a colorless to pale yellow liquid or solid, depending on its state at room temperature. The compound may exhibit moderate volatility and has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Safety data should be consulted, as the trifluoroacetate group can impart toxicity and environmental concerns. Overall, this compound represents a complex structure with potential utility in various chemical and biological applications.

Formula: C₁₃H₁₈N₂OC₂HF₃O₂

InChI: InChI=1S/C13H18N2O.C2HF3O2/c1-14-6-8-15(9-7-14)10-12-2-4-13(11-16)5-3-12;3-2(4,5)1(6)7/h2-5,11H,6-10H2,1H3;(H,6,7)

InChI key: PZZRWNKSVVQXSA-UHFFFAOYSA-N

SMILES: CN1CCN(CC1)CC2=CC=C(C=C2)C=O.C(=O)(C(F)(F)F)O

4-[(4-Methylpiperazin-1-yl)methyl]benzaldehyde 2,2,2-Trifluoroacetate

Controlled Product

CAS: 879484-77-2

Formula: C₁₃H₁₈N₂O•C₂HF₃O₂

Color and Shape: Neat

Molecular weight: 218.29 + 114.02

Ref: TR-M778880