CymitQuimica logo

CAS 879636-95-0

:

2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid

Description:
2-(3-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity. The presence of a methoxy group on the phenyl ring enhances its lipophilicity and may influence its biological activity. The methyl group at the 4-position of the thiazole ring can affect the compound's steric properties and overall stability. This compound may exhibit various pharmacological activities, making it of interest in medicinal chemistry. Its structural features suggest potential interactions with biological targets, which could be explored in drug development. Additionally, the compound's solubility, melting point, and other physical properties would depend on its molecular interactions and the presence of functional groups. Overall, 2-(3-methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid represents a unique structure with potential applications in pharmaceuticals and organic synthesis.
Formula:C12H11NO3S
InChI:InChI=1/C12H11NO3S/c1-7-10(12(14)15)17-11(13-7)8-4-3-5-9(6-8)16-2/h3-6H,1-2H3,(H,14,15)
InChI key:WFBWIROXKGGXAW-UHFFFAOYSA-N
SMILES:Cc1c(C(=O)O)sc(c2cccc(c2)OC)n1
Synonyms:
  • 5-Thiazolecarboxylic acid, 2-(3-methoxyphenyl)-4-methyl-
  • 2-(3-Methoxyphenyl)-4-methyl-1,3-thiazole-5-carboxylic acid
Found 4 products.