CymitQuimica logo

CAS 879648-22-3

:

4,4,5,5-Tetramethyl-2-(2-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-(2-(methylsulfonyl)phenyl)-1,3,2-dioxaborolane is an organoboron compound characterized by its dioxaborolane structure, which features a boron atom bonded to two oxygen atoms in a cyclic arrangement. This compound contains a sulfonyl group attached to a phenyl ring, contributing to its potential reactivity and solubility properties. The presence of the methylsulfonyl group enhances its polar characteristics, making it soluble in polar solvents. The tetramethyl substituents provide steric hindrance, which can influence its reactivity and stability. This compound is of interest in organic synthesis, particularly in cross-coupling reactions, due to the boron atom's ability to participate in nucleophilic substitutions. Additionally, its unique structure may impart specific electronic properties, making it useful in various applications, including pharmaceuticals and materials science. Safety data should be consulted for handling, as organoboron compounds can exhibit varying degrees of toxicity and reactivity.
Formula:C13H19BO4S
InChI:InChI=1S/C13H19BO4S/c1-12(2)13(3,4)18-14(17-12)10-8-6-7-9-11(10)19(5,15)16/h6-9H,1-5H3
InChI key:FGHAQXOPLXCRFH-UHFFFAOYSA-N
SMILES:B1(OC(C(O1)(C)C)(C)C)C2=CC=CC=C2S(=O)(=O)C
Found 4 products.