CAS 87969-65-1

1-Propanone, 1-(1,2-dihydro-5-acenaphthylenyl)-2-methyl-

Description:

1-Propanone, 1-(1,2-dihydro-5-acenaphthylenyl)-2-methyl-, also known by its CAS number 87969-65-1, is an organic compound characterized by its ketone functional group. This substance features a propanone backbone with a substituted acenaphthylene moiety, which contributes to its unique structural and chemical properties. Typically, compounds of this nature exhibit moderate volatility and may have distinct aromatic characteristics due to the presence of the acenaphthylene structure. The presence of the ketone group suggests that it may participate in various chemical reactions, such as nucleophilic addition or condensation reactions. Additionally, the compound may exhibit specific solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its potential applications could span across fields such as organic synthesis, materials science, or pharmaceuticals, depending on its reactivity and stability. As with many organic compounds, safety data should be consulted to understand its handling and toxicity profiles.

Formula: C₁₆H₁₆O

InChI: InChI=1S/C16H16O/c1-10(2)16(17)14-9-8-12-7-6-11-4-3-5-13(14)15(11)12/h3-5,8-10H,6-7H2,1-2H3

InChI key: ZIEZSDGXTVFMMF-UHFFFAOYSA-N

SMILES: CC(C)C(=O)C1=CC=C2CCC3=C2C1=CC=C3

1-(1,2-Dihydro-5-acenaphthylenyl)-2-methyl-1-propanone

CAS: 87969-65-1

1-(1,2-Dihydro-5-acenaphthylenyl)-2-methyl-1-propanone

Formula: C₁₆H₁₆O

Purity: 95%

Molecular weight: 224.3

Ref: 54-OR1144203