CymitQuimica logo

CAS 879896-59-0

:

N-methyl-1-(2-pyrrolidin-1-ylpyridin-4-yl)methanamine

Description:
N-methyl-1-(2-pyrrolidin-1-ylpyridin-4-yl)methanamine, identified by its CAS number 879896-59-0, is a chemical compound characterized by its complex structure, which includes a pyridine ring and a pyrrolidine moiety. This compound typically exhibits properties associated with amines, such as basicity and the ability to form hydrogen bonds. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of nitrogen atoms that can engage in dipole interactions. The presence of the pyridine and pyrrolidine rings suggests potential biological activity, possibly influencing neurotransmitter systems or serving as a scaffold for drug development. Its molecular structure may allow for various functionalizations, making it a candidate for further chemical modifications. As with many organic compounds, safety and handling precautions should be observed, as amines can be irritants and may have specific toxicity profiles. Overall, this compound's unique features make it of interest in medicinal chemistry and related fields.
Formula:C11H17N3
InChI:InChI=1/C11H17N3/c1-12-9-10-4-5-13-11(8-10)14-6-2-3-7-14/h4-5,8,12H,2-3,6-7,9H2,1H3
InChI key:KXGXBBZQYBQAKS-UHFFFAOYSA-N
SMILES:CNCc1ccnc(c1)N1CCCC1
Synonyms:
  • N-methyl-N-[(2-pyrrolidin-1-ylpyridin-4-yl)methyl]amine
Found 1 products.