CymitQuimica logo

CAS 87992-61-8

:

Acetamide, 2-chloro-N-[4-(6-methyl-2-benzothiazolyl)phenyl]-

Description:
Acetamide, 2-chloro-N-[4-(6-methyl-2-benzothiazolyl)phenyl]- is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a chloro substituent and a benzothiazole moiety, contributing to its unique chemical properties. The presence of the benzothiazole ring, which contains both sulfur and nitrogen, enhances its potential biological activity, making it of interest in pharmaceutical research. The compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its molecular structure suggests potential interactions with biological targets, which could be explored for applications in medicinal chemistry. Additionally, the chlorine atom may influence its reactivity and stability, affecting how it interacts with other chemical species. Safety data should be consulted for handling and storage, as halogenated compounds can pose specific health and environmental risks. Overall, this compound exemplifies the complexity and diversity of organic molecules used in various scientific fields.
Formula:C16H13ClN2OS
InChI:InChI=1S/C16H13ClN2OS/c1-10-2-7-13-14(8-10)21-16(19-13)11-3-5-12(6-4-11)18-15(20)9-17/h2-8H,9H2,1H3,(H,18,20)
InChI key:QJGSHPBQTMVTJR-UHFFFAOYSA-N
SMILES:CC1=CC2=C(C=C1)N=C(S2)C3=CC=C(C=C3)NC(=O)CCl
Found 3 products.