CymitQuimica logo

CAS 879996-61-9

:

1H-Pyrazole-4-carboxaldehyde, 3-(3-methylphenyl)-

Description:
1H-Pyrazole-4-carboxaldehyde, 3-(3-methylphenyl)- is an organic compound characterized by its pyrazole ring structure, which is a five-membered ring containing two nitrogen atoms. This compound features a carboxaldehyde functional group (-CHO) at the 4-position of the pyrazole ring, contributing to its reactivity and potential applications in organic synthesis. The presence of a 3-(3-methylphenyl) substituent indicates that there is a phenyl group with a methyl group at the meta position relative to the attachment point on the pyrazole. This substitution can influence the compound's physical and chemical properties, such as solubility, boiling point, and reactivity. The compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its CAS number, 879996-61-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound represents a unique structure that may have various applications in research and industry.
Formula:C11H10N2O
InChI:InChI=1S/C11H10N2O/c1-8-3-2-4-9(5-8)11-10(7-14)6-12-13-11/h2-7H,1H3,(H,12,13)
InChI key:DMYBJXNQJAEREE-UHFFFAOYSA-N
SMILES:CC1=CC(=CC=C1)C2=C(C=NN2)C=O
Found 2 products.