CymitQuimica logo

CAS 88010-00-8

:

1,3,5-Benzenetriamine, hydrochloride

Description:
1,3,5-Benzenetriamine, hydrochloride, is an organic compound characterized by the presence of three amine groups attached to a benzene ring, specifically at the 1, 3, and 5 positions. This compound appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility compared to the free base. It is primarily used in various chemical syntheses and as an intermediate in the production of dyes, pharmaceuticals, and other organic compounds. The presence of multiple amine groups allows for diverse reactivity, including the ability to form complexes with metals and participate in various coupling reactions. As with many amines, it may exhibit basic properties and can act as a nucleophile in chemical reactions. Safety precautions should be observed when handling this compound, as it may pose health risks such as irritation to the skin, eyes, and respiratory system. Proper storage and handling in a controlled environment are recommended to ensure safety and stability.
Formula:C6H9N3xClH
InChI:InChI=1S/C6H9N3.ClH/c7-4-1-5(8)3-6(9)2-4;/h1-3H,7-9H2;1H
InChI key:AJHDRXSTMDYFOL-UHFFFAOYSA-N
SMILES:C1=C(C=C(C=C1N)N)N.Cl
Found 2 products.