CymitQuimica logo

CAS 88023-83-0

:

Benzene, 1-methoxy-4-[[(methylthio)methoxy]methyl]-

Description:
Benzene, 1-methoxy-4-[[(methylthio)methoxy]methyl]- is an organic compound characterized by its aromatic benzene ring substituted with various functional groups. The presence of a methoxy group (-OCH3) and a methylthio group (-SCH3) indicates that this compound has both ether and thioether characteristics. The structure suggests that it may exhibit moderate polarity due to the methoxy substituent, while the methylthio group can influence its reactivity and solubility in organic solvents. This compound may participate in electrophilic aromatic substitution reactions typical of benzene derivatives. Additionally, the presence of sulfur in the methylthio group can impart unique properties, such as potential for coordination with metals or involvement in redox reactions. The compound's applications could span various fields, including pharmaceuticals, agrochemicals, and materials science, depending on its specific reactivity and interactions with other chemical species. Safety and handling considerations are essential, as with many organic compounds, due to potential toxicity and environmental impact.
Formula:C10H14O2S
InChI:InChI=1S/C10H14O2S/c1-11-10-5-3-9(4-6-10)7-12-8-13-2/h3-6H,7-8H2,1-2H3
InChI key:BTOPAHVWGRYACX-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)COCSC
Found 2 products.