CymitQuimica logo

CAS 88032-03-5

:

Benzenemethanamine, 2-(methoxymethyl)-

Description:
Benzenemethanamine, 2-(methoxymethyl)-, also known by its CAS number 88032-03-5, is an organic compound characterized by the presence of both an amine and a methoxy group attached to a benzene ring. This compound typically exhibits properties associated with aromatic amines, including a relatively high boiling point and moderate solubility in polar solvents due to the presence of the amine functional group. The methoxymethyl substituent enhances its reactivity and can influence its interaction with other chemical species. As an amine, it may participate in hydrogen bonding, which can affect its physical properties and reactivity. The compound is likely to be used in various applications, including as an intermediate in organic synthesis or in the production of pharmaceuticals and agrochemicals. Safety data should be consulted for handling and storage, as amines can be hazardous. Overall, the unique structure of this compound allows for diverse chemical behavior and potential applications in different fields of chemistry.
Formula:C9H13NO
InChI:InChI=1S/C9H13NO/c1-11-7-9-5-3-2-4-8(9)6-10/h2-5H,6-7,10H2,1H3
InChI key:NHRIWUULBXVLFS-UHFFFAOYSA-N
SMILES:COCC1=CC=CC=C1CN
Found 3 products.