CymitQuimica logo

CAS 88041-67-2

:

Phenol, 4-bromo-2-(methylsulfonyl)-

Description:
Phenol, 4-bromo-2-(methylsulfonyl)-, also known by its CAS number 88041-67-2, is an organic compound characterized by the presence of a phenolic hydroxyl group (-OH) attached to a benzene ring, which is further substituted with a bromine atom and a methylsulfonyl group (-SO2CH3). This compound typically exhibits properties associated with both phenols and sulfonyl compounds, including moderate solubility in polar solvents due to the hydroxyl and sulfonyl groups. The bromine substitution can influence its reactivity, making it a potential candidate for electrophilic aromatic substitution reactions. Additionally, the methylsulfonyl group can enhance the compound's polarity and may impart unique biological activities, making it of interest in medicinal chemistry and materials science. The presence of these functional groups suggests that it may participate in hydrogen bonding and could exhibit varying degrees of acidity and basicity, depending on the surrounding environment. Overall, this compound's structural features contribute to its potential applications in various chemical and pharmaceutical contexts.
Formula:C7H7BrO3S
InChI:InChI=1S/C7H7BrO3S/c1-12(10,11)7-4-5(8)2-3-6(7)9/h2-4,9H,1H3
InChI key:NUPADVWWKRDWOA-UHFFFAOYSA-N
SMILES:CS(=O)(=O)C1=C(C=CC(=C1)Br)O
Found 3 products.