CymitQuimica logo

CAS 88061-72-7

:

Propanimidamide,3-[[[2-[(aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]-,dihydrochloride

Description:
Propanimidamide, 3-[[[2-[(aminoiminomethyl)amino]-4-thiazolyl]methyl]thio]-, dihydrochloride is a chemical compound characterized by its complex structure, which includes a thiazole ring and multiple amino groups. This substance is typically classified as a thiazole derivative and is known for its potential biological activity, particularly in medicinal chemistry. The presence of the thiazole moiety often contributes to its pharmacological properties, making it of interest in drug development. The dihydrochloride form indicates that the compound is a salt, which can enhance its solubility and stability in aqueous solutions. Its molecular structure suggests that it may interact with biological targets through hydrogen bonding and other non-covalent interactions. As with many compounds containing amino groups, it may exhibit basic properties and can participate in various chemical reactions, including those typical of amines and thiazoles. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C8H14N6S2・2ClH
InChI:InChI=1S/C8H14N6S2.2ClH/c9-6(10)1-2-15-3-5-4-16-8(13-5)14-7(11)12;;/h4H,1-3H2,(H3,9,10)(H4,11,12,13,14);2*1H
InChI key:DYBCWNAWEYABGE-UHFFFAOYSA-N
SMILES:C1=C(N=C(S1)N=C(N)N)CSCCC(=N)N.Cl.Cl
Found 5 products.