CAS 880635-03-0
:N-[(2S)-2-[[(1Z)-1-Methyl-3-oxo-3-[4-(trifluoromethyl)phenyl]-1-propen-1-yl]amino]-3-[4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]phenyl]propyl]propanamide
Description:
The chemical substance N-[(2S)-2-[[(1Z)-1-Methyl-3-oxo-3-[4-(trifluoromethyl)phenyl]-1-propen-1-yl]amino]-3-[4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]phenyl]propyl]propanamide, with CAS number 880635-03-0, is a complex organic compound characterized by its intricate molecular structure, which includes multiple functional groups such as amides, ketones, and aromatic rings. This compound is likely to exhibit significant biological activity due to its structural features, which may interact with specific biological targets. The presence of trifluoromethyl and oxazole moieties suggests potential applications in medicinal chemistry, possibly as a pharmaceutical agent. Its stereochemistry, indicated by the (2S) configuration, may influence its pharmacokinetic properties and biological efficacy. Additionally, the compound's solubility, stability, and reactivity would depend on its molecular interactions, which are influenced by the various substituents present. Overall, this substance represents a class of compounds that may be of interest in drug discovery and development, particularly in the context of targeted therapies.
Formula:C35H36F3N3O4
InChI:InChI=1S/C35H36F3N3O4/c1-4-33(43)39-22-29(40-23(2)20-32(42)26-12-14-28(15-13-26)35(36,37)38)21-25-10-16-30(17-11-25)44-19-18-31-24(3)45-34(41-31)27-8-6-5-7-9-27/h5-17,20,29,40H,4,18-19,21-22H2,1-3H3,(H,39,43)/b23-20-/t29-/m0/s1
InChI key:InChIKey=TYEFSRMOUXWTDN-DYQICHDWSA-N
SMILES:C(COC1=CC=C(C[C@H](N/C(=C\C(=O)C2=CC=C(C(F)(F)F)C=C2)/C)CNC(CC)=O)C=C1)C=3N=C(OC3C)C4=CC=CC=C4
Synonyms:- GW 6471
- N-[(2S)-2-[[(1Z)-1-Methyl-3-oxo-3-[4-(trifluoromethyl)phenyl]-1-propen-1-yl]amino]-3-[4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]phenyl]propyl]propanamide
- Propanamide, N-[(2S)-2-[[(1Z)-1-methyl-3-oxo-3-[4-(trifluoromethyl)phenyl]-1-propenyl]amino]-3-[4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]phenyl]propyl]-
- Propanamide, N-[(2S)-2-[[(1Z)-1-methyl-3-oxo-3-[4-(trifluoromethyl)phenyl]-1-propen-1-yl]amino]-3-[4-[2-(5-methyl-2-phenyl-4-oxazolyl)ethoxy]phenyl]propyl]-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
GW6471
CAS:GW6471 is an antagonist of PPARα. GW6471 enhances the binding affinity of the PPAR α ligand-binding domain to the co-repressor proteins SMRT and NCoR.Formula:C35H36F3N3O4Purity:98.23% - 99.55%Color and Shape:SolidMolecular weight:619.67Ref: TM-T8486
2mg35.00€5mg52.00€10mg88.00€25mg177.00€50mg311.00€100mg533.00€200mg802.00€1mL*10mM (DMSO)87.00€GW 6471
CAS:GW 6471 is a small molecule that inhibits the ATP-binding cassette transporter, which is involved in the uptake of glucose and other nutrients. GW 6471 has been shown to inhibit cancer cells by reducing their energy metabolism and inhibiting mitochondrial membrane potential. It also induces apoptosis of 3T3-L1 preadipocytes by activating signal pathways involving growth factor-β1 and PPARα. This drug also has anti-inflammatory properties in an experimental model using mouse heart tissue. GW 6471 is being developed as a treatment for bowel disease and congestive heart failure.Formula:C35H36F3N3O4Purity:Min. 98 Area-%Color and Shape:PowderMolecular weight:619.67 g/mol






