CymitQuimica logo

CAS 880813-30-9

:

N-[(9-ethyl-9H-carbazol-3-yl)methyl]-N-(3-pyridinylmethyl)amine

Description:
N-[(9-ethyl-9H-carbazol-3-yl)methyl]-N-(3-pyridinylmethyl)amine is a chemical compound characterized by its complex structure, which includes a carbazole moiety and a pyridine ring. The presence of the ethyl group on the carbazole enhances its hydrophobic properties, while the pyridine ring introduces basicity and potential for hydrogen bonding. This compound is likely to exhibit significant biological activity due to its structural features, which may allow it to interact with various biological targets. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's CAS number, 880813-30-9, is a unique identifier that facilitates its identification in chemical databases. In terms of physical properties, it may exhibit moderate solubility in organic solvents and limited solubility in water, typical of many organic compounds with aromatic systems. Overall, N-[(9-ethyl-9H-carbazol-3-yl)methyl]-N-(3-pyridinylmethyl)amine represents a class of compounds that could be of interest for further research in drug discovery and development.
Formula:C21H21N3
InChI:InChI=1S/C21H21N3/c1-2-24-20-8-4-3-7-18(20)19-12-16(9-10-21(19)24)13-23-15-17-6-5-11-22-14-17/h3-12,14,23H,2,13,15H2,1H3
InChI key:GAVUWQFIRGBDHN-UHFFFAOYSA-N
SMILES:CCN1C2=C(C=C(C=C2)CNCC3=CN=CC=C3)C4=CC=CC=C41
Synonyms:
  • BLL5 Maleate
  • N-[(9-ethyl-9H-carbazol-3-yl)methyl]-N-(3-pyridinylmethyl)amine
Found 4 products.