CymitQuimica logo

CAS 88086-75-3

:

9H-Xanthene-2-carboxylic acid, 7-bromo-9-oxo-

Description:
9H-Xanthene-2-carboxylic acid, 7-bromo-9-oxo- is an organic compound characterized by its xanthene core structure, which consists of a fused ring system that includes a benzene ring and a pyran-like structure. This compound features a carboxylic acid functional group at the 2-position and a bromine atom at the 7-position, contributing to its reactivity and potential applications in various chemical reactions. The presence of the keto group at the 9-position enhances its electrophilic character, making it suitable for further derivatization. This compound is typically used in organic synthesis, particularly in the development of fluorescent dyes and as a building block in the synthesis of more complex organic molecules. Its unique structural features may also impart specific optical properties, making it of interest in materials science and photochemistry. As with many brominated compounds, it is important to handle it with care due to potential environmental and health impacts associated with bromine-containing substances.
Formula:C14H7BrO4
InChI:InChI=1S/C14H7BrO4/c15-8-2-4-12-10(6-8)13(16)9-5-7(14(17)18)1-3-11(9)19-12/h1-6H,(H,17,18)
InChI key:NNQLQGPSLAATKJ-UHFFFAOYSA-N
SMILES:C1=CC2=C(C=C1C(=O)O)C(=O)C3=C(O2)C=CC(=C3)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.