CAS 88086-86-6

Formula: C13H16O6

InChI: InChI=1S/C13H16O6/c1-7-10(15)11(16)12(17)13(18-7)19-9-4-2-8(6-14)3-5-9/h2-7,10-13,15-17H,1H3/t7-,10-,11+,12+,13-/m0/s1

InChI key: KTBXFUXBVKOEDM-HPMQQCADSA-N

SMILES: C[C@H]1[C@@H]([C@H]([C@H]([C@@H](O1)OC2=CC=C(C=C2)C=O)O)O)O

4-Hydroxybenzaldehyde rhamnoside

CAS: 88086-86-6

4-Hydroxybenzaldehyde rhamnoside

Molecular weight: 268.09

Ref: 10-F566517

4-Hydroxybenzaldehyde rhamnoside

CAS: 88086-86-6

4-Hydroxybenzaldehyde rhamnoside is a natural product for research related to life sciences. The catalog number is TN3040 and the CAS number is 88086-86-6.

Formula: C₁₃H₁₆O₆

Purity: 98%

Color and Shape: Solid

Molecular weight: 268.26

Ref: TM-TN3040

4-Hydroxybenzaldehyde rhamnoside

CAS: 88086-86-6

4-Hydroxybenzaldehyde rhamnoside is a glucosylated aromatic aldehyde, which is an intriguing biochemical compound derived from the glucosylation of 4-hydroxybenzaldehyde with rhamnose. This compound typically originates from plant or microbial sources, highlighting its presence in natural product chemistry. The mode of action of 4-Hydroxybenzaldehyde rhamnoside involves interaction with various biological systems, potentially contributing to antioxidant and anti-inflammatory activities due to its phenolic structure.

Formula: C₁₃H₁₆O₆

Purity: Min. 95%

Molecular weight: 268.26 g/mol

Ref: 3D-NDA08686