CymitQuimica logo

CAS 88088-31-7

:

Hydroxylamine, O-(diphenoxyphosphinyl)-

Description:
Hydroxylamine, O-(diphenoxyphosphinyl)- is a chemical compound characterized by its unique structure, which includes a hydroxylamine functional group and a diphenoxyphosphinyl moiety. This compound typically exhibits properties associated with both hydroxylamines and phosphinates, making it of interest in various chemical applications, including organic synthesis and potentially as a reagent in phosphorus chemistry. Hydroxylamines are known for their ability to act as reducing agents and nucleophiles, while phosphinates can participate in various chemical reactions due to the presence of the phosphorus atom. The presence of diphenoxy groups may enhance the compound's stability and solubility in organic solvents. Additionally, the compound may exhibit biological activity, although specific biological properties would require further investigation. Safety data should be consulted, as compounds containing phosphorus and nitrogen can pose hazards. Overall, Hydroxylamine, O-(diphenoxyphosphinyl)- represents a versatile chemical entity with potential applications in both industrial and research settings.
Formula:C12H12NO4P
InChI:InChI=1S/C12H12NO4P/c13-17-18(14,15-11-7-3-1-4-8-11)16-12-9-5-2-6-10-12/h1-10H,13H2
InChI key:UINZSQJVKLWNOU-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)OP(=O)(OC2=CC=CC=C2)ON
Found 2 products.