CymitQuimica logo

CAS 88092-70-0

:

Acetamide, N-(2-acetyl-4,6-dibromophenyl)-

Description:
Acetamide, N-(2-acetyl-4,6-dibromophenyl)-, is an organic compound characterized by its amide functional group, which is derived from acetic acid. This compound features a phenyl ring substituted with two bromine atoms at the 4 and 6 positions, as well as an acetyl group at the 2 position. The presence of bromine atoms contributes to its potential reactivity and influences its physical properties, such as solubility and boiling point. Acetamides generally exhibit moderate polarity due to the amide bond, which can engage in hydrogen bonding, affecting their solubility in polar solvents. The compound may be of interest in various fields, including pharmaceuticals and agrochemicals, due to its potential biological activity. Its synthesis typically involves the reaction of an appropriate brominated phenyl compound with acetic anhydride or acetic acid in the presence of a suitable catalyst. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.
Formula:C10H9Br2NO2
InChI:InChI=1S/C10H9Br2NO2/c1-5(14)8-3-7(11)4-9(12)10(8)13-6(2)15/h3-4H,1-2H3,(H,13,15)
InChI key:HDMYXVUUOGKKAA-UHFFFAOYSA-N
SMILES:CC(=O)C1=C(C(=CC(=C1)Br)Br)NC(=O)C
Found 3 products.