CymitQuimica logo

CAS 88105-09-3

:

4-(1H-benzimidazol-2-yl)-1-methyl-1H-pyrazol-5-amine

Description:
4-(1H-benzimidazol-2-yl)-1-methyl-1H-pyrazol-5-amine, identified by its CAS number 88105-09-3, is a chemical compound that features a complex structure comprising a benzimidazole moiety and a pyrazole ring. This compound typically exhibits characteristics such as being a solid at room temperature, with potential applications in medicinal chemistry due to its bioactive properties. The presence of both the benzimidazole and pyrazole groups suggests that it may interact with biological targets, potentially influencing various biochemical pathways. Its molecular structure allows for hydrogen bonding and π-π stacking interactions, which can enhance its solubility and stability in different solvents. Additionally, the compound may exhibit fluorescence properties, making it useful in various analytical applications. As with many organic compounds, its reactivity can be influenced by the functional groups present, and it may undergo various chemical reactions such as substitution or oxidation. Overall, this compound represents a class of heterocyclic compounds that are of interest in pharmaceutical research and development.
Formula:C11H11N5
InChI:InChI=1/C11H11N5/c1-16-10(12)7(6-13-16)11-14-8-4-2-3-5-9(8)15-11/h2-6H,12H2,1H3,(H,14,15)
InChI key:UOKZBKZOSOVCSP-UHFFFAOYSA-N
SMILES:Cn1c(c(cn1)c1nc2ccccc2[nH]1)N
Found 3 products.