
CAS 88105-17-3
:Methyl 3-chlorothiophene-2-carboxylate
Description:
Methyl 3-chlorothiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a chlorine atom at the 3-position and a carboxylate group at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to light yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic thiophene structure. Methyl 3-chlorothiophene-2-carboxylate can be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C6H5ClO2S
InChI:InChI=1/C6H5ClO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3
SMILES:COC(=O)c1c(ccs1)Cl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Methyl 3-Chlorothiophene-2-Carboxylate
CAS:Formula:C6H5ClO2SPurity:98%Color and Shape:SolidMolecular weight:176.6207methyl 3-chlorothiophene-2-carboxylate
CAS:methyl 3-chlorothiophene-2-carboxylatePurity:98%Molecular weight:176.62g/molMethyl 3-chlorothiophene-2-carboxylate
CAS:Formula:C6H5ClO2SPurity:97%Color and Shape:SolidMolecular weight:176.61METHYL 3-CHLOROTHIOPHENE-2-CARBOXYLATE
CAS:Methyl 3-chlorothiophene-2-carboxylate is a chemical compound that belongs to the group of heteroaromatic compounds. This chemical can be used for the synthesis of various products, such as esters and thiophenes. Methyl 3-chlorothiophene-2-carboxylate is an intermediate in the production of other chemicals, such as 2,5-dichlorothiophene and 1,3-dichloropropene. The product also has a catalytic effect, which can be used in reactions with other substances. It is possible to use this product for the synthesis of many different compounds by changing the reaction conditions.Formula:C6H5ClO2SPurity:Min. 95%Molecular weight:176.62 g/mol



