CymitQuimica logo

CAS 88105-17-3

:

Methyl 3-chlorothiophene-2-carboxylate

Description:
Methyl 3-chlorothiophene-2-carboxylate is an organic compound characterized by its thiophene ring, which is a five-membered aromatic heterocycle containing sulfur. The presence of a chlorine atom at the 3-position and a carboxylate group at the 2-position contributes to its reactivity and potential applications in organic synthesis. This compound typically appears as a colorless to light yellow liquid or solid, depending on its purity and specific conditions. It is soluble in organic solvents such as ethanol and dichloromethane, but may have limited solubility in water due to its hydrophobic thiophene structure. Methyl 3-chlorothiophene-2-carboxylate can be utilized in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it valuable in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Safety precautions should be observed when handling this compound, as it may pose health risks if inhaled or ingested, and appropriate personal protective equipment should be used.
Formula:C6H5ClO2S
InChI:InChI=1/C6H5ClO2S/c1-9-6(8)5-4(7)2-3-10-5/h2-3H,1H3
InChI key:ZWKYYONTMGVPSP-UHFFFAOYSA-N
SMILES:COC(=O)c1c(ccs1)Cl
Found 5 products.