CAS 88124-95-2
:1H-Isoindole-1,3(2H)-dione, 2-(10-undecenyl)-
Description:
1H-Isoindole-1,3(2H)-dione, 2-(10-undecenyl)-, with the CAS number 88124-95-2, is an organic compound characterized by its isoindole structure, which features a bicyclic framework consisting of a five-membered ring fused to a six-membered ring. This compound contains a dione functional group, indicating the presence of two carbonyl (C=O) groups, which contribute to its reactivity and potential applications in organic synthesis. The presence of a long undecenyl chain suggests that it may exhibit hydrophobic properties and could participate in various chemical reactions, including polymerization or conjugation with other molecules. Its unique structure may also impart specific biological activities, making it of interest in medicinal chemistry. The compound's physical properties, such as solubility, melting point, and boiling point, would depend on its molecular interactions and the presence of functional groups. Overall, 1H-Isoindole-1,3(2H)-dione, 2-(10-undecenyl)- is a versatile compound with potential applications in various fields, including pharmaceuticals and materials science.
Formula:C19H25NO2
InChI:InChI=1S/C19H25NO2/c1-2-3-4-5-6-7-8-9-12-15-20-18(21)16-13-10-11-14-17(16)19(20)22/h2,10-11,13-14H,1,3-9,12,15H2
InChI key:XOINLYWSOHEMFG-UHFFFAOYSA-N
SMILES:C=CCCCCCCCCCN1C(=O)C2=CC=CC=C2C1=O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
