CymitQuimica logo

CAS 881302-73-4

:

5-boronobenzene-1,3-dicarboxylic acid

Description:
5-Boronobenzene-1,3-dicarboxylic acid is an organic compound characterized by the presence of a boron atom attached to a benzene ring that also features two carboxylic acid groups at the 1 and 3 positions. This compound typically exhibits properties associated with both aromatic compounds and carboxylic acids, such as stability and the ability to participate in various chemical reactions, including esterification and coupling reactions. The boron atom can enhance the compound's reactivity, making it useful in applications such as organic synthesis and materials science, particularly in the development of boron-containing polymers or ligands in coordination chemistry. The presence of carboxylic acid groups contributes to its solubility in polar solvents and its potential for forming hydrogen bonds, which can influence its physical properties and reactivity. Overall, 5-boronobenzene-1,3-dicarboxylic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and materials development.
Formula:C8H7BO6
InChI:InChI=1/C8H7BO6/c10-7(11)4-1-5(8(12)13)3-6(2-4)9(14)15/h1-3,14-15H,(H,10,11)(H,12,13)
InChI key:LCDXMCXNZRXUDH-UHFFFAOYSA-N
SMILES:c1c(cc(cc1C(=O)O)B(O)O)C(=O)O
Synonyms:
  • 5-Borono-1,3-Benzenedicarboxylic Acid
  • 3,5-Dicarboxyphenylboronic acid
  • 3,5-Dicarboxybenzeneboronic acid
Found 6 products.