CymitQuimica logo

CAS 88149-44-4

:

Benzenamine, 2,4-dibromo-6-(difluoromethoxy)-

Description:
Benzenamine, 2,4-dibromo-6-(difluoromethoxy)-, also known by its CAS number 88149-44-4, is an organic compound characterized by its aromatic amine structure. It features a benzene ring substituted with two bromine atoms at the 2 and 4 positions, and a difluoromethoxy group at the 6 position. This compound exhibits properties typical of halogenated aromatic amines, including potential reactivity due to the presence of the bromine substituents, which can influence its chemical behavior and interactions. The difluoromethoxy group adds to its complexity, potentially affecting its solubility and polarity. Such compounds are often of interest in various fields, including pharmaceuticals and agrochemicals, due to their biological activity and potential applications. Safety considerations are important, as halogenated compounds can pose environmental and health risks. Overall, the unique combination of functional groups in this compound contributes to its distinct chemical properties and potential utility in research and industry.
Formula:C7H5Br2F2NO
InChI:InChI=1S/C7H5Br2F2NO/c8-3-1-4(9)6(12)5(2-3)13-7(10)11/h1-2,7H,12H2
InChI key:CWNZDWKGKADMQG-UHFFFAOYSA-N
SMILES:C1=C(C=C(C(=C1OC(F)F)N)Br)Br
Found 1 products.