CymitQuimica logo

CAS 88150-53-2

:

3,5-Pyridinedicarboxylic acid,2-[(2-aminoethoxy)methyl]-1,4-dihydro-6-methyl-4-phenyl-, 3-ethyl5-methyl ester, (2E)-2-butenedioate (1:1)

Description:
3,5-Pyridinedicarboxylic acid, 2-[(2-aminoethoxy)methyl]-1,4-dihydro-6-methyl-4-phenyl-, 3-ethyl-5-methyl ester, (2E)-2-butenedioate (1:1) is a complex organic compound characterized by its pyridine ring structure, which is substituted with multiple functional groups. This compound features both carboxylic acid and ester functionalities, indicating potential for reactivity and solubility in various solvents. The presence of an aminoethoxy side chain suggests it may exhibit biological activity, possibly interacting with biological systems or serving as a precursor for pharmaceutical applications. The dihydro and methyl substitutions on the pyridine ring contribute to its steric and electronic properties, influencing its reactivity and stability. Additionally, the compound's structural complexity may allow for diverse interactions, making it of interest in medicinal chemistry and material science. Its CAS number, 88150-53-2, provides a unique identifier for regulatory and research purposes, facilitating its study and application in various chemical contexts.
Formula:C20H26N2O5・C4H4O4
InChI:InChI=1S/C20H26N2O5.C4H4O4/c1-4-27-20(24)18-15(12-26-11-10-21)22-13(2)16(19(23)25-3)17(18)14-8-6-5-7-9-14;5-3(6)1-2-4(7)8/h5-9,17,22H,4,10-12,21H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1+
InChI key:ZKGDJGRZQDCFMF-WLHGVMLRSA-N
SMILES:CCOC(=O)C1=C(NC(=C(C1C2=CC=CC=C2)C(=O)OC)C)COCCN.C(=C/C(=O)O)\C(=O)O
Found 5 products.