CymitQuimica logo

CAS 88159-06-2

:

Silane, (1,1-dimethylethyl)diphenyl(2-propynyloxy)-

Description:
Silane, (1,1-dimethylethyl)diphenyl(2-propynyloxy)-, with CAS number 88159-06-2, is an organosilicon compound characterized by its silane functional group, which contains silicon bonded to organic groups. This compound features a tert-butyl group (1,1-dimethylethyl), two phenyl groups (diphenyl), and a propynyl ether moiety (2-propynyloxy), indicating a complex structure that combines both silicon and carbon-based functionalities. Silanes like this one are often used in various applications, including as coupling agents, surface modifiers, and precursors in the synthesis of silicon-based materials. The presence of multiple aromatic rings can enhance stability and provide unique electronic properties, while the propynyl group may contribute to reactivity in polymerization or cross-linking processes. Safety data sheets typically indicate that such compounds should be handled with care, as they may pose risks such as flammability or skin irritation. Overall, the unique combination of functional groups in this silane makes it a versatile compound in materials science and organic chemistry.
Formula:C19H22OSi
InChI:InChI=1S/C19H22OSi/c1-5-16-20-21(19(2,3)4,17-12-8-6-9-13-17)18-14-10-7-11-15-18/h1,6-15H,16H2,2-4H3
InChI key:FCIMVIXBNIWHMA-UHFFFAOYSA-N
SMILES:CC(C)(C)[Si](C1=CC=CC=C1)(C2=CC=CC=C2)OCC#C
Found 3 products.