CAS 88167-50-4

Benzonitrile, 2-amino-5-(bromoacetyl)-

Description:

Benzonitrile, 2-amino-5-(bromoacetyl)-, also known by its CAS number 88167-50-4, is an organic compound characterized by the presence of a benzonitrile moiety with an amino group and a bromoacetyl substituent. This compound typically exhibits a white to light yellow crystalline appearance. It is soluble in polar organic solvents, reflecting its polar functional groups, while being less soluble in non-polar solvents. The presence of the amino group suggests potential basicity, while the bromoacetyl group introduces reactivity, particularly in nucleophilic substitution reactions. The compound may also participate in various chemical reactions, including acylation and amination, making it useful in synthetic organic chemistry. Its structure allows for potential applications in pharmaceuticals and agrochemicals, where modifications can lead to biologically active derivatives. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, this compound is of interest for its chemical reactivity and potential applications in various fields of chemistry.

Formula: C₉H₇BrN₂O

InChI: InChI=1S/C9H7BrN2O/c10-4-9(13)6-1-2-8(12)7(3-6)5-11/h1-3H,4,12H2

InChI key: UJEZJLWSDUCAEA-UHFFFAOYSA-N

SMILES: C1=CC(=C(C=C1C(=O)CBr)C#N)N

2-Amino-5-(2-bromoacetyl)benzonitrile hydrobromide

CAS: 88167-50-4

Please enquire for more information about 2-Amino-5-(2-bromoacetyl)benzonitrile hydrobromide including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₉H₇BrN₂O

Purity: Min. 95%

Molecular weight: 239.07 g/mol

Ref: 3D-NDA16750