CymitQuimica logo

CAS 88167-63-9

:

Hexadecanoic acid, 10-(acetyloxy)-, methyl ester

Description:
Hexadecanoic acid, 10-(acetyloxy)-, methyl ester, also known as methyl 10-acetoxyhexadecanoate, is an ester derived from hexadecanoic acid (palmitic acid) and acetic acid. This compound features a long hydrophobic hydrocarbon chain, which contributes to its lipophilic properties, making it soluble in organic solvents but less soluble in water. The presence of the acetoxy group introduces a polar functional group, which can enhance its reactivity and potential applications in organic synthesis. Typically, esters like this one are used in various fields, including cosmetics, food flavoring, and as intermediates in chemical synthesis. The compound may exhibit characteristics such as low volatility and stability under standard conditions, but it can undergo hydrolysis in the presence of water or strong acids/bases. Its molecular structure suggests potential for biological activity, and it may interact with biological membranes due to its amphiphilic nature. As with many esters, it is important to handle this compound with care, considering safety data and potential hazards associated with its use.
Formula:C19H36O4
InChI:InChI=1S/C19H36O4/c1-4-5-6-11-14-18(23-17(2)20)15-12-9-7-8-10-13-16-19(21)22-3/h18H,4-16H2,1-3H3
InChI key:AKJPOVLMWCPDOS-UHFFFAOYSA-N
SMILES:CCCCCCC(CCCCCCCCC(=O)OC)OC(=O)C
Found 1 products.