CAS 88170-21-2
:Anthracene, 9,9,10-trifluoro-9,10-dihydro-10-phenyl-
Description:
Anthracene, 9,9,10-trifluoro-9,10-dihydro-10-phenyl- is a fluorinated derivative of anthracene, characterized by the presence of trifluoromethyl groups and a phenyl substituent. This compound typically exhibits a polycyclic aromatic structure, which contributes to its stability and potential applications in organic electronics and materials science. The trifluoromethyl groups enhance its chemical properties, such as increased lipophilicity and altered electronic characteristics, making it of interest in various chemical reactions and applications. The presence of the phenyl group can influence its solubility and reactivity, potentially allowing for interactions with other organic compounds. Additionally, the compound may exhibit unique photophysical properties, such as fluorescence, which can be harnessed in optoelectronic devices. As with many fluorinated compounds, it is essential to consider its environmental impact and stability under various conditions. Overall, this compound represents a fascinating area of study within the field of organic chemistry, particularly in the context of developing new materials with tailored properties.
Formula:C20H13F3
InChI:InChI=1S/C20H13F3/c21-19(14-8-2-1-3-9-14)15-10-4-6-12-17(15)20(22,23)18-13-7-5-11-16(18)19/h1-13H
InChI key:VNEWYMFKUFODFO-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2(C3=CC=CC=C3C(C4=CC=CC=C42)(F)F)F
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
