CymitQuimica logo

CAS 88170-93-8

:

L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-mercapto-

Description:
L-Phenylalanine, N-[(1,1-dimethylethoxy)carbonyl]-4-mercapto- is a chemical compound that belongs to the class of amino acids, specifically a derivative of phenylalanine. It features a mercapto group (-SH) at the para position of the phenyl ring, which can participate in redox reactions and form disulfide bonds. The presence of the N-[(1,1-dimethylethoxy)carbonyl] group indicates that it has a protective carbamate moiety, which can enhance its stability and solubility in organic solvents. This compound is likely to exhibit properties typical of amino acids, such as being polar and capable of forming hydrogen bonds. Its mercapto group may also impart unique reactivity, making it useful in various biochemical applications, including peptide synthesis and as a potential building block in drug development. Additionally, the compound's structure suggests it may have specific interactions with biological systems, which could be explored for therapeutic purposes. As with many amino acid derivatives, it is important to handle this compound with care, considering its potential reactivity and biological implications.
Formula:C14H19NO4S
InChI:InChI=1S/C14H19NO4S/c1-14(2,3)19-13(18)15-11(12(16)17)8-9-4-6-10(20)7-5-9/h4-7,11,20H,8H2,1-3H3,(H,15,18)(H,16,17)/t11-/m0/s1
InChI key:HTJUIVWAFJEXGZ-NSHDSACASA-N
SMILES:CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)S)C(=O)O
Found 1 products.