CAS 88172-38-7

Benzimidazo[1,2-a]quinoline-6-carbonitrile, 5,7-dihydro-7-methyl-5-oxo-

Description:

Benzimidazo[1,2-a]quinoline-6-carbonitrile, 5,7-dihydro-7-methyl-5-oxo- is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both benzimidazole and quinoline moieties. This compound features a carbonitrile functional group, contributing to its reactivity and potential applications in medicinal chemistry. The presence of a methyl group and a carbonyl group enhances its chemical properties, influencing its solubility and interaction with biological targets. Typically, compounds of this nature exhibit interesting pharmacological activities, including antimicrobial, anticancer, or anti-inflammatory properties, making them subjects of research in drug development. The molecular structure allows for various substitution patterns, which can be explored to optimize biological activity. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, Benzimidazo[1,2-a]quinoline-6-carbonitrile, 5,7-dihydro-7-methyl-5-oxo- represents a significant class of compounds in the field of organic and medicinal chemistry, with potential applications in therapeutic development.

Formula: C₁₇H₁₁N₃O

InChI: InChI=1S/C17H11N3O/c1-19-14-8-4-5-9-15(14)20-13-7-3-2-6-11(13)16(21)12(10-18)17(19)20/h2-9H,1H3

InChI key: XRQNYPHNZPECFW-UHFFFAOYSA-N

SMILES: CN1C2=CC=CC=C2N3C1=C(C(=O)C4=CC=CC=C43)C#N

Benzimidazo[1,2-a]quinoline-6-carbonitrile, 5,7-dihydro-7-methyl-5-oxo-

CAS: 88172-38-7

Formula: C₁₇H₁₁N₃O

Molecular weight: 273.2887

Ref: IN-DA004DT0