CymitQuimica logo

CAS 881903-14-6

:

Acetic acid, chlorodifluoro-, 3,4-dichloro-1-ethylbutyl ester

Description:
Acetic acid, chlorodifluoro-, 3,4-dichloro-1-ethylbutyl ester, with the CAS number 881903-14-6, is an organic compound characterized by its ester functional group derived from acetic acid and a chlorinated alkyl chain. This compound features multiple chlorine substituents, which can significantly influence its chemical properties, including its reactivity and polarity. The presence of chlorodifluoromethyl groups suggests that it may exhibit unique characteristics such as increased stability and potential applications in various chemical processes. Typically, esters like this one are known for their pleasant odors and are often used in flavoring and fragrance applications. However, the chlorinated nature of this compound may also impart specific environmental and health considerations, necessitating careful handling and assessment of its toxicity and ecological impact. Overall, the unique structure of this ester makes it a subject of interest in both synthetic chemistry and industrial applications, particularly in the fields of agrochemicals and specialty chemicals.
Formula:C8H11Cl3F2O2
InChI:InChI=1S/C8H11Cl3F2O2/c1-2-6(3-5(10)4-9)15-7(14)8(11,12)13/h5-6H,2-4H2,1H3
InChI key:BPAKBGATBGNBKY-UHFFFAOYSA-N
SMILES:CCC(CC(CCl)Cl)OC(=O)C(F)(F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.