CAS 88220-31-9

Benzenemethanol, 2-(naphtho[2,3-b]thien-2-ylmethyl)-

Description:

Benzenemethanol, 2-(naphtho[2,3-b]thien-2-ylmethyl)-, identified by its CAS number 88220-31-9, is an organic compound characterized by its complex structure, which includes a benzyl alcohol moiety and a naphtho[2,3-b]thienyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential hydrophobicity due to its extensive aromatic system. It may display moderate to high solubility in organic solvents, while being less soluble in water. The presence of the naphtho[2,3-b]thienyl group suggests potential applications in organic electronics or as a building block in the synthesis of more complex molecules. Additionally, compounds of this nature may exhibit interesting biological activities, making them subjects of interest in medicinal chemistry. The stability and reactivity of this compound can be influenced by the functional groups present, and it may participate in various chemical reactions typical of aromatic compounds, such as electrophilic substitution. Overall, its unique structure and properties make it a valuable compound for research and application in various fields of chemistry.

Formula: C₂₀H₁₆OS

InChI: InChI=1S/C20H16OS/c21-13-17-8-4-3-6-15(17)10-19-11-18-9-14-5-1-2-7-16(14)12-20(18)22-19/h1-9,11-12,21H,10,13H2

InChI key: ZAQMKBIVXXKWNR-UHFFFAOYSA-N

SMILES: C1=CC=C2C=C3C(=CC2=C1)C=C(S3)CC4=CC=CC=C4CO

Benzenemethanol, 2-(naphtho[2,3-b]thien-2-ylmethyl)-

CAS: 88220-31-9

Formula: C₂₀H₁₆OS

Molecular weight: 304.4054

Ref: IN-DA004BAY