CymitQuimica logo

CAS 88223-35-2

:

9H-Fluorene, 2-bromo-9,9-dibutyl-

Description:
9H-Fluorene, 2-bromo-9,9-dibutyl- is an organic compound characterized by its structure, which includes a fluorene backbone with two butyl groups and a bromine substituent at the 2-position. This compound is part of the polycyclic aromatic hydrocarbons family, known for their stability and unique electronic properties. The presence of the bromine atom introduces reactivity, making it useful in various chemical reactions, such as cross-coupling reactions in organic synthesis. The butyl groups enhance its solubility in organic solvents and can influence its physical properties, such as melting and boiling points. Additionally, the compound may exhibit interesting photophysical properties, making it a candidate for applications in organic electronics or materials science. Safety data should be consulted, as brominated compounds can pose environmental and health risks. Overall, 9H-Fluorene, 2-bromo-9,9-dibutyl- is a versatile compound with potential applications in research and industry, particularly in the fields of organic chemistry and materials development.
Formula:C21H25Br
InChI:InChI=1S/C21H25Br/c1-3-5-13-21(14-6-4-2)19-10-8-7-9-17(19)18-12-11-16(22)15-20(18)21/h7-12,15H,3-6,13-14H2,1-2H3
InChI key:AVCNDQUBVOMMSL-UHFFFAOYSA-N
SMILES:CCCCC1(C2=CC=CC=C2C3=C1C=C(C=C3)Br)CCCC
Found 5 products.