CAS 88226-94-2
:Pyrrolidine, 1-[2-(1-methylethenyl)-1-oxo-4-pentenyl]-
Description:
Pyrrolidine, 1-[2-(1-methylethenyl)-1-oxo-4-pentenyl]- is a chemical compound characterized by its pyrrolidine ring structure, which is a five-membered nitrogen-containing heterocycle. This compound features a substituent that includes a vinyl group and a ketone functional group, contributing to its reactivity and potential applications in organic synthesis. The presence of the methylethenyl group indicates that it has unsaturation, which can participate in various chemical reactions, such as polymerization or addition reactions. The compound's molecular structure suggests it may exhibit interesting biological activities, making it a candidate for research in medicinal chemistry. Additionally, its unique functional groups may impart specific physical properties, such as solubility and volatility, which are important for its handling and application in laboratory settings. As with many organic compounds, safety data should be consulted to understand its toxicity and environmental impact. Overall, this compound represents a versatile structure with potential utility in various chemical and pharmaceutical applications.
Formula:C12H19NO
InChI:InChI=1S/C12H19NO/c1-4-7-11(10(2)3)12(14)13-8-5-6-9-13/h4,11H,1-2,5-9H2,3H3
InChI key:DGTODLINFMQBSJ-UHFFFAOYSA-N
SMILES:CC(=C)C(CC=C)C(=O)N1CCCC1
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
