CymitQuimica logo

CAS 88234-81-5

:

3-Pyrrolidinecarboxylic acid, 4-(2-benzofuranyl)-2-oxo-

Description:
3-Pyrrolidinecarboxylic acid, 4-(2-benzofuranyl)-2-oxo- is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a benzofuran moiety. This compound typically exhibits properties associated with both cyclic amines and carboxylic acids, such as potential solubility in polar solvents and the ability to participate in hydrogen bonding due to the presence of the carboxylic acid functional group. The benzofuran component may contribute to its aromatic characteristics, influencing its reactivity and interaction with biological systems. This compound may also exhibit specific biological activities, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential applications in various fields, including pharmaceuticals and agrochemicals. As with many organic compounds, the stability and reactivity can be influenced by environmental factors such as pH and temperature. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H11NO4
InChI:InChI=1S/C13H11NO4/c15-12-11(13(16)17)8(6-14-12)10-5-7-3-1-2-4-9(7)18-10/h1-5,8,11H,6H2,(H,14,15)(H,16,17)
InChI key:XSPMGTRNNWVXHV-UHFFFAOYSA-N
SMILES:C1C(C(C(=O)N1)C(=O)O)C2=CC3=CC=CC=C3O2
Synonyms:
  • 4-(benzofuran-2-yl)-2-oxopyrrolidine-3-carboxylic acid
  • 3-Pyrrolidinecarboxylic acid, 4-(2-benzofuranyl)-2-oxo-
  • 4-(benzofuran-2-yl)-2-oxopyrrolidine-3-carboxylic acid(WXC06060)
Found 1 products.