CAS 88235-30-7
:Benzene, 1,2-dimethoxy-4-[2-(methylthio)ethenyl]-
Description:
Benzene, 1,2-dimethoxy-4-[2-(methylthio)ethenyl]- is an organic compound characterized by its aromatic benzene ring substituted with two methoxy groups and a vinyl group containing a methylthio substituent. The presence of the methoxy groups enhances its solubility in organic solvents and can influence its reactivity and interaction with other chemical species. The methylthio group introduces a sulfur atom, which can impart unique properties such as increased nucleophilicity and potential for further chemical transformations. This compound may exhibit interesting biological activities due to its structural features, making it of interest in fields such as medicinal chemistry and materials science. Its molecular structure suggests potential applications in organic synthesis and as a precursor for more complex molecules. As with many aromatic compounds, it is important to consider its stability, reactivity, and safety profile during handling and use in laboratory or industrial settings.
Formula:C11H14O2S
InChI:InChI=1S/C11H14O2S/c1-12-10-5-4-9(6-7-14-3)8-11(10)13-2/h4-8H,1-3H3
InChI key:GYAOILJAQGXZEI-UHFFFAOYSA-N
SMILES:COC1=C(C=C(C=C1)C=CSC)OC
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
