CymitQuimica logo

CAS 88235-70-5

:

2-Imidazolidinone, 5-(hydroxyamino)-3,4,4-trimethyl-1-phenyl-

Description:
2-Imidazolidinone, 5-(hydroxyamino)-3,4,4-trimethyl-1-phenyl- is a chemical compound characterized by its imidazolidinone core structure, which features a five-membered ring containing two nitrogen atoms. This compound includes a hydroxyamino group, contributing to its potential reactivity and solubility in various solvents. The presence of three methyl groups at the 3, 4, and 4 positions of the ring enhances its steric bulk, which may influence its biological activity and interaction with other molecules. Additionally, the phenyl group attached to the imidazolidinone structure can provide aromatic characteristics, potentially affecting its electronic properties and stability. The compound is likely to exhibit polar characteristics due to the hydroxyamino group, making it soluble in polar solvents. Its unique structure suggests potential applications in pharmaceuticals or as a chemical intermediate, although specific applications would depend on further research into its properties and reactivity. Safety data and handling precautions should be consulted due to the presence of nitrogen-containing functional groups, which may pose specific hazards.
Formula:C12H17N3O2
InChI:InChI=1S/C12H17N3O2/c1-12(2)10(13-17)15(11(16)14(12)3)9-7-5-4-6-8-9/h4-8,10,13,17H,1-3H3
InChI key:USFMPYJRUOOMMZ-UHFFFAOYSA-N
SMILES:CC1(C(N(C(=O)N1C)C2=CC=CC=C2)NO)C
Found 1 products.