CymitQuimica logo

CAS 88235-77-2

:

2,4-Imidazolidinedione, 1,5,5-trimethyl-3-phenyl-, 4-oxime, (Z)-

Description:
2,4-Imidazolidinedione, 1,5,5-trimethyl-3-phenyl-, 4-oxime, commonly referred to by its CAS number 88235-77-2, is a chemical compound characterized by its imidazolidinedione core structure, which features a five-membered ring containing two nitrogen atoms and two carbonyl groups. This compound exhibits properties typical of oximes, including the presence of a hydroxylamine functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the trimethyl and phenyl substituents enhances its steric and electronic properties, potentially influencing its solubility and reactivity in various chemical environments. As an oxime derivative, it may participate in condensation reactions and serve as a precursor for further chemical transformations. Its specific applications can vary, but compounds of this nature are often explored in medicinal chemistry and materials science for their unique structural features and reactivity profiles. Safety and handling precautions should be observed, as with all chemical substances, due to potential hazards associated with their use.
Formula:C12H15N3O2
InChI:InChI=1S/C12H15N3O2/c1-12(2)10(13-17)15(11(16)14(12)3)9-7-5-4-6-8-9/h4-8,17H,1-3H3
InChI key:BLDJPSCGHLRYLV-UHFFFAOYSA-N
SMILES:CC1(C(=NO)N(C(=O)N1C)C2=CC=CC=C2)C
Found 1 products.