CAS 88236-22-0
:Phenol, 2-[4-(4-phenyl-1H-1,2,3-triazol-1-yl)-2-pyrimidinyl]-
Description:
Phenol, 2-[4-(4-phenyl-1H-1,2,3-triazol-1-yl)-2-pyrimidinyl]- is a chemical compound characterized by its complex structure, which includes a phenolic group and a triazole moiety linked to a pyrimidine ring. This compound typically exhibits properties associated with both phenolic and heterocyclic compounds, such as potential antioxidant activity and the ability to participate in hydrogen bonding due to the presence of hydroxyl (-OH) groups. The triazole and pyrimidine components may contribute to its biological activity, making it of interest in medicinal chemistry and drug development. The presence of multiple aromatic rings suggests that it may have significant π-π stacking interactions, which can influence its solubility and reactivity. Additionally, the compound may exhibit various pharmacological properties, including antimicrobial or anticancer activities, although specific biological effects would depend on further empirical studies. Overall, this compound represents a class of heterocyclic phenolic compounds with potential applications in pharmaceuticals and materials science.
Formula:C18H13N5O
InChI:InChI=1S/C18H13N5O/c24-16-9-5-4-8-14(16)18-19-11-10-17(20-18)23-12-15(21-22-23)13-6-2-1-3-7-13/h1-12,24H
InChI key:CKLVEJFPALDBGI-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C2=CN(N=N2)C3=NC(=NC=C3)C4=CC=CC=C4O
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Phenol, 2-[4-(4-phenyl-1H-1,2,3-triazol-1-yl)-2-pyrimidinyl]-
CAS:Formula:C18H13N5OMolecular weight:315.3287
