CymitQuimica logo

CAS 88237-22-3

:

1,2-Benzisoxazol-7-amine

Description:
1,2-Benzisoxazol-7-amine is an organic compound characterized by its bicyclic structure, which consists of a benzene ring fused to an isoxazole ring. This compound features an amino group (-NH2) at the 7-position of the isoxazole, contributing to its reactivity and potential biological activity. It is typically a white to off-white solid and is soluble in polar organic solvents. The presence of the amino group allows for hydrogen bonding, which can influence its solubility and interaction with other molecules. 1,2-Benzisoxazol-7-amine is of interest in medicinal chemistry due to its potential applications in drug development, particularly in the fields of neuropharmacology and anti-inflammatory research. Its unique structure may also confer specific pharmacological properties, making it a subject of study for various therapeutic targets. As with many organic compounds, handling should be done with care, considering safety data and potential hazards associated with its use.
Formula:C7H6N2O
InChI:InChI=1S/C7H6N2O/c8-6-3-1-2-5-4-9-10-7(5)6/h1-4H,8H2
InChI key:YQTMYTBXEPKNOP-UHFFFAOYSA-N
SMILES:C1=CC2=C(C(=C1)N)ON=C2
Found 3 products.